Acetamide, 2-chloro-N-cyclohexyl-

Acetamide, 2-chloro-N-cyclohexyl- - Names and Identifiers

Name	2-Chloro-N-cyclohexylacetamide
Synonyms	AKOS B015663 AKOS BBS-00004074 ART-CHEM-BB B015663 CHEMBRDG-BB 3015663 2-Chloro-N-cyclohexylacetamide 2-CHLORO-N-CYCLOHEXYL-ACETAMIDE 2-Chloro-N-cyclohexyl-acetamide 2-chloro-N-cyclohexyl-ethanamide Acetamide, 2-chloro-N-cyclohexyl-
CAS	23605-23-4
InChI	InChI=1/C8H14ClNO/c9-6-8(11)10-7-4-2-1-3-5-7/h7H,1-6H2,(H,10,11)

Acetamide, 2-chloro-N-cyclohexyl- - Physico-chemical Properties

Molecular Formula	C8H14ClNO
Molar Mass	175.66
Density	1.10±0.1 g/cm3(Predicted)
Melting Point	109-111°C
Boling Point	326.4±21.0 °C(Predicted)
Flash Point	151.2°C
Vapor Presure	0.000216mmHg at 25°C
pKa	13.97±0.20(Predicted)
Storage Condition	2-8°C
Refractive Index	1.484

Acetamide, 2-chloro-N-cyclohexyl- - Risk and Safety

Hazard Symbols	Xi - Irritant
Hazard Class	IRRITANT

Acetamide, 2-chloro-N-cyclohexyl- - Introduction

The chemical formula is C8H15ClNO, which is an organic compound. Its properties are as follows:

1. Appearance: Colorless or light yellow solid.
2. Solubility: It can be dissolved in many organic solvents, such as ethanol and chloroform.
3. Melting Point: its melting point range between 82-85 ° C.
4. Molecular Weight: its relative molecular mass is 181.66.

The applications of the dye are mainly concentrated in the field of medicine:
1. It is an important active drug intermediate and is often used as an intermediate for the synthesis of other drugs such as aromatic compounds.
2. It is also used to prevent or inhibit the growth of bacteria or other microorganisms.

It can be prepared by the following synthesis methods:
Cyclohexylamine is reacted with Chloroacetyl Chloride under suitable reaction conditions to generate calcium.

The following safety precautions should be paid attention to when using the ball:
1. Need to avoid contact with skin and eyes, avoid inhalation or ingestion of the compound.
2. Wear appropriate personal protective equipment during operation, such as lab gloves, protective glasses and dust mask.
3. When stored, it should be sealed and kept away from fire and combustible materials.

Last Update：2024-04-09 19:05:48